ChemNet > CAS > 82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
| Produkt-Name |
methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate |
| Englischer Name |
methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate;methyl (2Z)-2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate; methyl 2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate |
| Molekulare Formel |
C12H12Cl2N2O3 |
| Molecular Weight |
303.1413 |
| InChI |
InChI=1/C12H12Cl2N2O3/c1-6(15-2)10(12(18)19-3)11(17)7-4-8(13)16-9(14)5-7/h4-5,15H,1-3H3 |
| CAS Registry Number |
82140-55-4 |
| Molecular Structure |
![82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate](https://images-a.chemnet.com/suppliers/chembase/cas11/cas82140-55-4.gif)
|
| Dichte |
1.34g/cm3 |
| Schmelzpunkt |
112℃ |
| Siedepunkt |
462.9°C at 760 mmHg |
| Brechungsindex |
1.553 |
| Flammpunkt |
233.8°C |
| Dampfdruck |
9.48E-09mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
